About N-cyclohexa-2,5-dien-1-ylideneacetamide
N-cyclohexa-2,5-dien-1-ylideneacetamide (PubChem CID 86008157) has the molecular formula C8H8NO+
and a molecular weight of 134.16 g/mol. Its IUPAC name is N-cyclohexa-2,5-dien-1-ylideneacetamide.
Molecular Properties
| Compound Name | N-cyclohexa-2,5-dien-1-ylideneacetamide |
| PubChem CID | 86008157 |
| Molecular Formula | C8H8NO+ |
| Molecular Weight | 134.16 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | N-cyclohexa-2,5-dien-1-ylideneacetamide |
| SMILES | CC(=O)N=C1C=C[CH+]C=C1 |
| InChI | InChI=1S/C8H8NO/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3/q+1 |
| InChIKey | FYKBECLONWOAKW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.16 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexa-2,5-dien-1-ylideneacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexa-2,5-dien-1-ylideneacetamide?
The IUPAC name of N-cyclohexa-2,5-dien-1-ylideneacetamide (CID 86008157) is N-cyclohexa-2,5-dien-1-ylideneacetamide.
What is the SMILES notation for N-cyclohexa-2,5-dien-1-ylideneacetamide?
The canonical SMILES for N-cyclohexa-2,5-dien-1-ylideneacetamide is CC(=O)N=C1C=C[CH+]C=C1.
What is the InChIKey of N-cyclohexa-2,5-dien-1-ylideneacetamide?
The InChIKey is FYKBECLONWOAKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8NO/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3/q+1.
What are the key properties of N-cyclohexa-2,5-dien-1-ylideneacetamide?
N-cyclohexa-2,5-dien-1-ylideneacetamide has a molecular weight of 134.16 g/mol, XLogP of 1.30, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexa-2,5-dien-1-ylideneacetamide is sourced from PubChem (CID 86008157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).