About 3,5-dimethyl-2-methylidene-1,3-thiazolidine
3,5-dimethyl-2-methylidene-1,3-thiazolidine (PubChem CID 86018233) has the molecular formula C6H11NS
and a molecular weight of 129.23 g/mol. Its IUPAC name is 3,5-dimethyl-2-methylidene-1,3-thiazolidine.
Analyze 3,5-dimethyl-2-methylidene-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-2-methylidene-1,3-thiazolidine?
The IUPAC name of 3,5-dimethyl-2-methylidene-1,3-thiazolidine (CID 86018233) is 3,5-dimethyl-2-methylidene-1,3-thiazolidine.
What is the SMILES notation for 3,5-dimethyl-2-methylidene-1,3-thiazolidine?
The canonical SMILES for 3,5-dimethyl-2-methylidene-1,3-thiazolidine is C=C1SC(C)CN1C.
What is the InChIKey of 3,5-dimethyl-2-methylidene-1,3-thiazolidine?
The InChIKey is UIMXLWAUXLODRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NS/c1-5-4-7(3)6(2)8-5/h5H,2,4H2,1,3H3.
What are the key properties of 3,5-dimethyl-2-methylidene-1,3-thiazolidine?
3,5-dimethyl-2-methylidene-1,3-thiazolidine has a molecular weight of 129.23 g/mol, XLogP of 1.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-2-methylidene-1,3-thiazolidine is sourced from PubChem (CID 86018233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).