C19H19N3O2S2 — CID 8602094
5,6-dimethyl-2-[(E)-3-oxo-3-pyrrolidin-1-yl-1-thiophen-2-ylprop-1-en-2-yl]-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 8602094) has the molecular formula C19H19N3O2S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 5,6-dimethyl-2-[(E)-3-oxo-3-pyrrolidin-1-yl-1-thiophen-2-ylprop-1-en-2-yl]-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5,6-dimethyl-2-[(E)-3-oxo-3-pyrrolidin-1-yl-1-thiophen-2-ylprop-1-en-2-yl]-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 8602094 |
| Molecular Formula | C19H19N3O2S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 5,6-dimethyl-2-[(E)-3-oxo-3-pyrrolidin-1-yl-1-thiophen-2-ylprop-1-en-2-yl]-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(/C(=C\c3cccs3)C(=O)N3CCCC3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C19H19N3O2S2/c1-11-12(2)26-18-15(11)17(23)20-16(21-18)14(10-13-6-5-9-25-13)19(24)22-7-3-4-8-22/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,20,21,23)/b14-10+ |
| InChIKey | YZNOXTWRTWDLMB-GXDHUFHOSA-N |
| XLogP | 3.83 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|