C11H15I — CID 86029684
7-iodo-3,7a-dimethyl-1,2,4,5-tetrahydroindene (PubChem CID 86029684) has the molecular formula C11H15I and a molecular weight of 274.14 g/mol. Its IUPAC name is 7-iodo-3,7a-dimethyl-1,2,4,5-tetrahydroindene.
| Compound Name | 7-iodo-3,7a-dimethyl-1,2,4,5-tetrahydroindene |
|---|---|
| PubChem CID | 86029684 |
| Molecular Formula | C11H15I |
| Molecular Weight | 274.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 7-iodo-3,7a-dimethyl-1,2,4,5-tetrahydroindene |
| SMILES | CC1=C2CCC=C(I)C2(C)CC1 |
| InChI | InChI=1S/C11H15I/c1-8-6-7-11(2)9(8)4-3-5-10(11)12/h5H,3-4,6-7H2,1-2H3 |
| InChIKey | TWOHOHVJSWATTE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.14 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|