C13H15NO2 — CID 86032168
1-(phenylmethoxymethyl)-2,3-dihydropyridin-6-one (PubChem CID 86032168) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 1-(phenylmethoxymethyl)-2,3-dihydropyridin-6-one.
| Compound Name | 1-(phenylmethoxymethyl)-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 86032168 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 1-(phenylmethoxymethyl)-2,3-dihydropyridin-6-one |
| SMILES | O=C1C=CCCN1COCc1ccccc1 |
| InChI | InChI=1S/C13H15NO2/c15-13-8-4-5-9-14(13)11-16-10-12-6-2-1-3-7-12/h1-4,6-8H,5,9-11H2 |
| InChIKey | LUZQJALVWYPVCE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |