C17H10F4O4 — CID 86038552
5,7-bis(difluoromethoxy)-2-phenylchromen-4-one (PubChem CID 86038552) has the molecular formula C17H10F4O4 and a molecular weight of 354.26 g/mol. Its IUPAC name is 5,7-bis(difluoromethoxy)-2-phenylchromen-4-one.
| Compound Name | 5,7-bis(difluoromethoxy)-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 86038552 |
| Molecular Formula | C17H10F4O4 |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 5,7-bis(difluoromethoxy)-2-phenylchromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2cc(OC(F)F)cc(OC(F)F)c12 |
| InChI | InChI=1S/C17H10F4O4/c18-16(19)23-10-6-13-15(14(7-10)25-17(20)21)11(22)8-12(24-13)9-4-2-1-3-5-9/h1-8,16-17H |
| InChIKey | DAVVPQBJLCQNLB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |