C17H16N4O4S — CID 86042560
9H-fluoren-9-ylmethyl N-(2-azidosulfonylethyl)carbamate (PubChem CID 86042560) has the molecular formula C17H16N4O4S and a molecular weight of 372.41 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(2-azidosulfonylethyl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(2-azidosulfonylethyl)carbamate |
|---|---|
| PubChem CID | 86042560 |
| Molecular Formula | C17H16N4O4S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(2-azidosulfonylethyl)carbamate |
| SMILES | [N-]=[N+]=NS(=O)(=O)CCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C17H16N4O4S/c18-20-21-26(23,24)10-9-19-17(22)25-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16H,9-11H2,(H,19,22) |
| InChIKey | LKKLTYSPZGNHRZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 121.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|