C24H34N2O5S — CID 21271314
N,N-diethylethanamine;3-(9H-fluoren-9-ylmethoxycarbonylamino)propane-1-sulfonic acid (PubChem CID 21271314) has the molecular formula C24H34N2O5S and a molecular weight of 462.61 g/mol. Its IUPAC name is N,N-diethylethanamine;3-(9H-fluoren-9-ylmethoxycarbonylamino)propane-1-sulfonic acid.
| Compound Name | N,N-diethylethanamine;3-(9H-fluoren-9-ylmethoxycarbonylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 21271314 |
| Molecular Formula | C24H34N2O5S |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | N,N-diethylethanamine;3-(9H-fluoren-9-ylmethoxycarbonylamino)propane-1-sulfonic acid |
| SMILES | CCN(CC)CC.O=C(NCCCS(=O)(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C18H19NO5S.C6H15N/c20-18(19-10-5-11-25(21,22)23)24-12-17-15-8-3-1-6-13(15)14-7-2-4-9-16(14)17;1-4-7(5-2)6-3/h1-4,6-9,17H,5,10-12H2,(H,19,20)(H,21,22,23);4-6H2,1-3H3 |
| InChIKey | CHZPBKBABVKGQQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|