C24H24N2O3 — CID 86051368
1-[[2-(furan-2-yl)-7-methoxy-1-benzofuran-4-yl]methyl]-4-phenylpiperazine (PubChem CID 86051368) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 1-[[2-(furan-2-yl)-7-methoxy-1-benzofuran-4-yl]methyl]-4-phenylpiperazine.
| Compound Name | 1-[[2-(furan-2-yl)-7-methoxy-1-benzofuran-4-yl]methyl]-4-phenylpiperazine |
|---|---|
| PubChem CID | 86051368 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 1-[[2-(furan-2-yl)-7-methoxy-1-benzofuran-4-yl]methyl]-4-phenylpiperazine |
| SMILES | COc1ccc(CN2CCN(c3ccccc3)CC2)c2cc(-c3ccco3)oc12 |
| InChI | InChI=1S/C24H24N2O3/c1-27-22-10-9-18(20-16-23(29-24(20)22)21-8-5-15-28-21)17-25-11-13-26(14-12-25)19-6-3-2-4-7-19/h2-10,15-16H,11-14,17H2,1H3 |
| InChIKey | AMRMEAQHFDVQON-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 41.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |