C12H12BrNO4S — CID 86065713
3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 86065713) has the molecular formula C12H12BrNO4S and a molecular weight of 346.20 g/mol. Its IUPAC name is 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 86065713 |
| Molecular Formula | C12H12BrNO4S |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(Br)c(CN2C(=O)CSC2=O)cc1OC |
| InChI | InChI=1S/C12H12BrNO4S/c1-17-9-3-7(8(13)4-10(9)18-2)5-14-11(15)6-19-12(14)16/h3-4H,5-6H2,1-2H3 |
| InChIKey | OJRFLJGWLPJEDF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|