C18H29NO — CID 86068110
2-ethyl-3,4,4,6-tetramethyl-2-(2-phenylethyl)-1,3-oxazinane (PubChem CID 86068110) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is 2-ethyl-3,4,4,6-tetramethyl-2-(2-phenylethyl)-1,3-oxazinane.
| Compound Name | 2-ethyl-3,4,4,6-tetramethyl-2-(2-phenylethyl)-1,3-oxazinane |
|---|---|
| PubChem CID | 86068110 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 2-ethyl-3,4,4,6-tetramethyl-2-(2-phenylethyl)-1,3-oxazinane |
| SMILES | CCC1(CCc2ccccc2)OC(C)CC(C)(C)N1C |
| InChI | InChI=1S/C18H29NO/c1-6-18(13-12-16-10-8-7-9-11-16)19(5)17(3,4)14-15(2)20-18/h7-11,15H,6,12-14H2,1-5H3 |
| InChIKey | JBOSGYJORUYROE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |