C11H14N2 — CID 86075363
2,2-dimethyl-4-phenyl-1,5-dihydroimidazole (PubChem CID 86075363) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 2,2-dimethyl-4-phenyl-1,5-dihydroimidazole.
| Compound Name | 2,2-dimethyl-4-phenyl-1,5-dihydroimidazole |
|---|---|
| PubChem CID | 86075363 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2,2-dimethyl-4-phenyl-1,5-dihydroimidazole |
| SMILES | CC1(C)N=C(c2ccccc2)CN1 |
| InChI | InChI=1S/C11H14N2/c1-11(2)12-8-10(13-11)9-6-4-3-5-7-9/h3-7,12H,8H2,1-2H3 |
| InChIKey | SEZXYUXOSWIKPX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |