C12H12N2S2 — CID 86086367
1-phenylethyl pyrazole-1-carbodithioate (PubChem CID 86086367) has the molecular formula C12H12N2S2 and a molecular weight of 248.38 g/mol. Its IUPAC name is 1-phenylethyl pyrazole-1-carbodithioate.
| Compound Name | 1-phenylethyl pyrazole-1-carbodithioate |
|---|---|
| PubChem CID | 86086367 |
| Molecular Formula | C12H12N2S2 |
| Molecular Weight | 248.38 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 1-phenylethyl pyrazole-1-carbodithioate |
| SMILES | CC(SC(=S)n1cccn1)c1ccccc1 |
| InChI | InChI=1S/C12H12N2S2/c1-10(11-6-3-2-4-7-11)16-12(15)14-9-5-8-13-14/h2-10H,1H3 |
| InChIKey | AMZCLRANOBDIRZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|