C18H12O — CID 86088693
5-phenyl-2H-acenaphthylen-1-one (PubChem CID 86088693) has the molecular formula C18H12O and a molecular weight of 244.29 g/mol. Its IUPAC name is 5-phenyl-2H-acenaphthylen-1-one.
| Compound Name | 5-phenyl-2H-acenaphthylen-1-one |
|---|---|
| PubChem CID | 86088693 |
| Molecular Formula | C18H12O |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 5-phenyl-2H-acenaphthylen-1-one |
| SMILES | O=C1Cc2ccc(-c3ccccc3)c3cccc1c23 |
| InChI | InChI=1S/C18H12O/c19-17-11-13-9-10-14(12-5-2-1-3-6-12)15-7-4-8-16(17)18(13)15/h1-10H,11H2 |
| InChIKey | PFIZGXPZUQXXOF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |