methyl 2-(dipropylamino)ethanesulfonate

C9H21NO3S — CID 86089149

IUPACmethyl 2-(dipropylamino)ethanesulfonate
SMILESCCCN(CCC)CCS(=O)(=O)OC
InChIInChI=1S/C9H21NO3S/c1-4-6-10(7-5-2)8-9-14(11,12)13-3/h4-9H2,1-3H3
InChIKeyNFRSRTDCUMULFC-UHFFFAOYSA-N
MW223.34 g/mol
LogP1.08
Rot. Bonds8

About methyl 2-(dipropylamino)ethanesulfonate

methyl 2-(dipropylamino)ethanesulfonate (PubChem CID 86089149) has the molecular formula C9H21NO3S and a molecular weight of 223.34 g/mol. Its IUPAC name is methyl 2-(dipropylamino)ethanesulfonate.

Molecular Properties

Compound Namemethyl 2-(dipropylamino)ethanesulfonate
PubChem CID86089149
Molecular FormulaC9H21NO3S
Molecular Weight223.34 g/mol
Exact Mass223.12
IUPAC Namemethyl 2-(dipropylamino)ethanesulfonate
SMILESCCCN(CCC)CCS(=O)(=O)OC
InChIInChI=1S/C9H21NO3S/c1-4-6-10(7-5-2)8-9-14(11,12)13-3/h4-9H2,1-3H3
InChIKeyNFRSRTDCUMULFC-UHFFFAOYSA-N
XLogP1.08
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.34
LogP ≤ 51.08
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}

Analyze methyl 2-(dipropylamino)ethanesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(dipropylamino)ethanesulfonate?
The IUPAC name of methyl 2-(dipropylamino)ethanesulfonate (CID 86089149) is methyl 2-(dipropylamino)ethanesulfonate.
What is the SMILES notation for methyl 2-(dipropylamino)ethanesulfonate?
The canonical SMILES for methyl 2-(dipropylamino)ethanesulfonate is CCCN(CCC)CCS(=O)(=O)OC.
What is the InChIKey of methyl 2-(dipropylamino)ethanesulfonate?
The InChIKey is NFRSRTDCUMULFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21NO3S/c1-4-6-10(7-5-2)8-9-14(11,12)13-3/h4-9H2,1-3H3.
What are the key properties of methyl 2-(dipropylamino)ethanesulfonate?
methyl 2-(dipropylamino)ethanesulfonate has a molecular weight of 223.34 g/mol, XLogP of 1.08, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(dipropylamino)ethanesulfonate is sourced from PubChem (CID 86089149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).