C18H25NO — CID 86092683
4,4-dimethyl-2-[1-(2-methylphenyl)cyclohexyl]-5H-1,3-oxazole (PubChem CID 86092683) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 4,4-dimethyl-2-[1-(2-methylphenyl)cyclohexyl]-5H-1,3-oxazole.
| Compound Name | 4,4-dimethyl-2-[1-(2-methylphenyl)cyclohexyl]-5H-1,3-oxazole |
|---|---|
| PubChem CID | 86092683 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 4,4-dimethyl-2-[1-(2-methylphenyl)cyclohexyl]-5H-1,3-oxazole |
| SMILES | Cc1ccccc1C1(C2=NC(C)(C)CO2)CCCCC1 |
| InChI | InChI=1S/C18H25NO/c1-14-9-5-6-10-15(14)18(11-7-4-8-12-18)16-19-17(2,3)13-20-16/h5-6,9-10H,4,7-8,11-13H2,1-3H3 |
| InChIKey | BNNLCXYENQNEJE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |