About phenoxazin-1-imine
phenoxazin-1-imine (PubChem CID 86103991) has the molecular formula C12H8N2O
and a molecular weight of 196.21 g/mol. Its IUPAC name is phenoxazin-1-imine.
Molecular Properties
| Compound Name | phenoxazin-1-imine |
| PubChem CID | 86103991 |
| Molecular Formula | C12H8N2O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | phenoxazin-1-imine |
| SMILES | [H]/N=c1\cccc2oc3ccccc3nc1-2 |
| InChI | InChI=1S/C12H8N2O/c13-8-4-3-7-11-12(8)14-9-5-1-2-6-10(9)15-11/h1-7,13H/b13-8+ |
| InChIKey | BPRNHQPYFHCUMP-MDWZMJQESA-N |
| XLogP | 2.41 |
| TPSA | 49.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze phenoxazin-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenoxazin-1-imine?
The IUPAC name of phenoxazin-1-imine (CID 86103991) is phenoxazin-1-imine.
What is the SMILES notation for phenoxazin-1-imine?
The canonical SMILES for phenoxazin-1-imine is [H]/N=c1\cccc2oc3ccccc3nc1-2.
What is the InChIKey of phenoxazin-1-imine?
The InChIKey is BPRNHQPYFHCUMP-MDWZMJQESA-N. The full InChI is InChI=1S/C12H8N2O/c13-8-4-3-7-11-12(8)14-9-5-1-2-6-10(9)15-11/h1-7,13H/b13-8+.
What are the key properties of phenoxazin-1-imine?
phenoxazin-1-imine has a molecular weight of 196.21 g/mol, XLogP of 2.41, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenoxazin-1-imine is sourced from PubChem (CID 86103991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).