About 2,3-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one
2,3-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one (PubChem CID 86107084) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is 2,3-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one.
Analyze 2,3-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one?
The IUPAC name of 2,3-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one (CID 86107084) is 2,3-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one.
What is the SMILES notation for 2,3-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one?
The canonical SMILES for 2,3-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one is CC1(C)C=CC(O)=C(O)C1=O.
What is the InChIKey of 2,3-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one?
The InChIKey is AFFBMDWPWKHBLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-8(2)4-3-5(9)6(10)7(8)11/h3-4,9-10H,1-2H3.
What are the key properties of 2,3-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one?
2,3-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one has a molecular weight of 154.16 g/mol, XLogP of 1.48, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one is sourced from PubChem (CID 86107084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).