C15H13ClN2 — CID 86110463
3-chloro-N,5-dimethylacridin-9-amine (PubChem CID 86110463) has the molecular formula C15H13ClN2 and a molecular weight of 256.74 g/mol. Its IUPAC name is 3-chloro-N,5-dimethylacridin-9-amine.
| Compound Name | 3-chloro-N,5-dimethylacridin-9-amine |
|---|---|
| PubChem CID | 86110463 |
| Molecular Formula | C15H13ClN2 |
| Molecular Weight | 256.74 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 3-chloro-N,5-dimethylacridin-9-amine |
| SMILES | CNc1c2ccc(Cl)cc2nc2c(C)cccc12 |
| InChI | InChI=1S/C15H13ClN2/c1-9-4-3-5-12-14(9)18-13-8-10(16)6-7-11(13)15(12)17-2/h3-8H,1-2H3,(H,17,18) |
| InChIKey | HZWNNVQMLLEZCZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.74 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|