About 3-[[3-(2-ethylhexoxy)-2,2-dimethylpropoxy]methyl]heptane
3-[[3-(2-ethylhexoxy)-2,2-dimethylpropoxy]methyl]heptane (PubChem CID 86123306) has the molecular formula C21H44O2
and a molecular weight of 328.58 g/mol. Its IUPAC name is 3-[[3-(2-ethylhexoxy)-2,2-dimethylpropoxy]methyl]heptane.
Molecular Properties
| Compound Name | 3-[[3-(2-ethylhexoxy)-2,2-dimethylpropoxy]methyl]heptane |
| PubChem CID | 86123306 |
| Molecular Formula | C21H44O2 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 328.33 |
| IUPAC Name | 3-[[3-(2-ethylhexoxy)-2,2-dimethylpropoxy]methyl]heptane |
| SMILES | CCCCC(CC)COCC(C)(C)COCC(CC)CCCC |
| InChI | InChI=1S/C21H44O2/c1-7-11-13-19(9-3)15-22-17-21(5,6)18-23-16-20(10-4)14-12-8-2/h19-20H,7-18H2,1-6H3 |
| InChIKey | KAJQSBPHESQHSW-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[3-(2-ethylhexoxy)-2,2-dimethylpropoxy]methyl]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-(2-ethylhexoxy)-2,2-dimethylpropoxy]methyl]heptane?
The IUPAC name of 3-[[3-(2-ethylhexoxy)-2,2-dimethylpropoxy]methyl]heptane (CID 86123306) is 3-[[3-(2-ethylhexoxy)-2,2-dimethylpropoxy]methyl]heptane.
What is the SMILES notation for 3-[[3-(2-ethylhexoxy)-2,2-dimethylpropoxy]methyl]heptane?
The canonical SMILES for 3-[[3-(2-ethylhexoxy)-2,2-dimethylpropoxy]methyl]heptane is CCCCC(CC)COCC(C)(C)COCC(CC)CCCC.
What is the InChIKey of 3-[[3-(2-ethylhexoxy)-2,2-dimethylpropoxy]methyl]heptane?
The InChIKey is KAJQSBPHESQHSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44O2/c1-7-11-13-19(9-3)15-22-17-21(5,6)18-23-16-20(10-4)14-12-8-2/h19-20H,7-18H2,1-6H3.
What are the key properties of 3-[[3-(2-ethylhexoxy)-2,2-dimethylpropoxy]methyl]heptane?
3-[[3-(2-ethylhexoxy)-2,2-dimethylpropoxy]methyl]heptane has a molecular weight of 328.58 g/mol, XLogP of 6.48, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-(2-ethylhexoxy)-2,2-dimethylpropoxy]methyl]heptane is sourced from PubChem (CID 86123306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).