C16H18O6 — CID 86150262
2-(1,1-dimethoxy-2-oxo-3-phenylpropyl)-3-methoxy-2H-furan-5-one (PubChem CID 86150262) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is 2-(1,1-dimethoxy-2-oxo-3-phenylpropyl)-3-methoxy-2H-furan-5-one.
| Compound Name | 2-(1,1-dimethoxy-2-oxo-3-phenylpropyl)-3-methoxy-2H-furan-5-one |
|---|---|
| PubChem CID | 86150262 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-(1,1-dimethoxy-2-oxo-3-phenylpropyl)-3-methoxy-2H-furan-5-one |
| SMILES | COC1=CC(=O)OC1C(OC)(OC)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H18O6/c1-19-12-10-14(18)22-15(12)16(20-2,21-3)13(17)9-11-7-5-4-6-8-11/h4-8,10,15H,9H2,1-3H3 |
| InChIKey | SRWYFPJUYBXVHD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|