C18H17N3O — CID 86155680
2-[2-(3-naphthalen-2-yloxypropyl)-1H-imidazol-5-yl]acetonitrile (PubChem CID 86155680) has the molecular formula C18H17N3O and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-[2-(3-naphthalen-2-yloxypropyl)-1H-imidazol-5-yl]acetonitrile.
| Compound Name | 2-[2-(3-naphthalen-2-yloxypropyl)-1H-imidazol-5-yl]acetonitrile |
|---|---|
| PubChem CID | 86155680 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-[2-(3-naphthalen-2-yloxypropyl)-1H-imidazol-5-yl]acetonitrile |
| SMILES | N#CCc1cnc(CCCOc2ccc3ccccc3c2)[nH]1 |
| InChI | InChI=1S/C18H17N3O/c19-10-9-16-13-20-18(21-16)6-3-11-22-17-8-7-14-4-1-2-5-15(14)12-17/h1-2,4-5,7-8,12-13H,3,6,9,11H2,(H,20,21) |
| InChIKey | NRYYKVLIKLHQSB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|