C11H11NO2 — CID 86161812
4-benzyl-2-methyl-2H-1,3-oxazol-5-one (PubChem CID 86161812) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 4-benzyl-2-methyl-2H-1,3-oxazol-5-one.
| Compound Name | 4-benzyl-2-methyl-2H-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 86161812 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 4-benzyl-2-methyl-2H-1,3-oxazol-5-one |
| SMILES | CC1N=C(Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C11H11NO2/c1-8-12-10(11(13)14-8)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3 |
| InChIKey | LYQKLPODHDOOPY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |