C12H7F6NO2 — CID 12534593
4-benzyl-2,2-bis(trifluoromethyl)-1,3-oxazol-5-one (PubChem CID 12534593) has the molecular formula C12H7F6NO2 and a molecular weight of 311.18 g/mol. Its IUPAC name is 4-benzyl-2,2-bis(trifluoromethyl)-1,3-oxazol-5-one.
| Compound Name | 4-benzyl-2,2-bis(trifluoromethyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 12534593 |
| Molecular Formula | C12H7F6NO2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 4-benzyl-2,2-bis(trifluoromethyl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(C(F)(F)F)(C(F)(F)F)N=C1Cc1ccccc1 |
| InChI | InChI=1S/C12H7F6NO2/c13-11(14,15)10(12(16,17)18)19-8(9(20)21-10)6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | CQSZQHGHFFMXSX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |