C14H15F2NO3 — CID 91208524
methyl 4,4-difluoro-2-(2-oxoethylimino)-5-phenylpentanoate (PubChem CID 91208524) has the molecular formula C14H15F2NO3 and a molecular weight of 283.27 g/mol. Its IUPAC name is methyl 4,4-difluoro-2-(2-oxoethylimino)-5-phenylpentanoate.
| Compound Name | methyl 4,4-difluoro-2-(2-oxoethylimino)-5-phenylpentanoate |
|---|---|
| PubChem CID | 91208524 |
| Molecular Formula | C14H15F2NO3 |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | methyl 4,4-difluoro-2-(2-oxoethylimino)-5-phenylpentanoate |
| SMILES | COC(=O)/C(CC(F)(F)Cc1ccccc1)=N\CC=O |
| InChI | InChI=1S/C14H15F2NO3/c1-20-13(19)12(17-7-8-18)10-14(15,16)9-11-5-3-2-4-6-11/h2-6,8H,7,9-10H2,1H3/b17-12- |
| InChIKey | QACYVDSGPRFWQO-ATVHPVEESA-N |
| XLogP | 2.07 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|