C17H21F2NO4 — CID 91059450
methyl 3-[4-(1,1-difluoroethyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoate (PubChem CID 91059450) has the molecular formula C17H21F2NO4 and a molecular weight of 341.35 g/mol. Its IUPAC name is methyl 3-[4-(1,1-difluoroethyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoate.
| Compound Name | methyl 3-[4-(1,1-difluoroethyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoate |
|---|---|
| PubChem CID | 91059450 |
| Molecular Formula | C17H21F2NO4 |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | methyl 3-[4-(1,1-difluoroethyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoate |
| SMILES | COC(=O)C(Cc1ccc(C(C)(F)F)cc1)=NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H21F2NO4/c1-16(2,3)24-15(22)20-13(14(21)23-5)10-11-6-8-12(9-7-11)17(4,18)19/h6-9H,10H2,1-5H3 |
| InChIKey | CWXDSNLWVBIVOL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|