C7H5FN2O3S — CID 86163699
2-fluoroimidazo[1,2-a]pyridine-3-sulfonic acid (PubChem CID 86163699) has the molecular formula C7H5FN2O3S and a molecular weight of 216.19 g/mol. Its IUPAC name is 2-fluoroimidazo[1,2-a]pyridine-3-sulfonic acid.
| Compound Name | 2-fluoroimidazo[1,2-a]pyridine-3-sulfonic acid |
|---|---|
| PubChem CID | 86163699 |
| Molecular Formula | C7H5FN2O3S |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | 2-fluoroimidazo[1,2-a]pyridine-3-sulfonic acid |
| SMILES | O=S(=O)(O)c1c(F)nc2ccccn12 |
| InChI | InChI=1S/C7H5FN2O3S/c8-6-7(14(11,12)13)10-4-2-1-3-5(10)9-6/h1-4H,(H,11,12,13) |
| InChIKey | JMKVBZOANVRPGW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|