C10H10N2O3S — CID 95564366
3-methyl-2-methylsulfonylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 95564366) has the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. Its IUPAC name is 3-methyl-2-methylsulfonylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-methyl-2-methylsulfonylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 95564366 |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 3-methyl-2-methylsulfonylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1c(S(C)(=O)=O)nc2ccccn2c1=O |
| InChI | InChI=1S/C10H10N2O3S/c1-7-9(16(2,14)15)11-8-5-3-4-6-12(8)10(7)13/h3-6H,1-2H3 |
| InChIKey | DNAAZSHQERLICK-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 68.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |