methyl triazolo[1,5-a]pyridine-3-carboxylate

C8H7N3O2 — CID 86164709

IUPACmethyl triazolo[1,5-a]pyridine-3-carboxylate
SMILESCOC(=O)c1nnn2ccccc12
InChIInChI=1S/C8H7N3O2/c1-13-8(12)7-6-4-2-3-5-11(6)10-9-7/h2-5H,1H3
InChIKeyYXNPFPBARDKEEA-UHFFFAOYSA-N
MW177.16 g/mol
LogP0.52
Rot. Bonds1

About methyl triazolo[1,5-a]pyridine-3-carboxylate

methyl triazolo[1,5-a]pyridine-3-carboxylate (PubChem CID 86164709) has the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. Its IUPAC name is methyl triazolo[1,5-a]pyridine-3-carboxylate.

Molecular Properties

Compound Namemethyl triazolo[1,5-a]pyridine-3-carboxylate
PubChem CID86164709
Molecular FormulaC8H7N3O2
Molecular Weight177.16 g/mol
Exact Mass177.05
IUPAC Namemethyl triazolo[1,5-a]pyridine-3-carboxylate
SMILESCOC(=O)c1nnn2ccccc12
InChIInChI=1S/C8H7N3O2/c1-13-8(12)7-6-4-2-3-5-11(6)10-9-7/h2-5H,1H3
InChIKeyYXNPFPBARDKEEA-UHFFFAOYSA-N
XLogP0.52
TPSA56.49 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500177.16
LogP ≤ 50.52
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl triazolo[1,5-a]pyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl triazolo[1,5-a]pyridine-3-carboxylate?
The IUPAC name of methyl triazolo[1,5-a]pyridine-3-carboxylate (CID 86164709) is methyl triazolo[1,5-a]pyridine-3-carboxylate.
What is the SMILES notation for methyl triazolo[1,5-a]pyridine-3-carboxylate?
The canonical SMILES for methyl triazolo[1,5-a]pyridine-3-carboxylate is COC(=O)c1nnn2ccccc12.
What is the InChIKey of methyl triazolo[1,5-a]pyridine-3-carboxylate?
The InChIKey is YXNPFPBARDKEEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c1-13-8(12)7-6-4-2-3-5-11(6)10-9-7/h2-5H,1H3.
What are the key properties of methyl triazolo[1,5-a]pyridine-3-carboxylate?
methyl triazolo[1,5-a]pyridine-3-carboxylate has a molecular weight of 177.16 g/mol, XLogP of 0.52, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl triazolo[1,5-a]pyridine-3-carboxylate is sourced from PubChem (CID 86164709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).