C13H7Cl5O — CID 86183672
1,2,4-trichloro-5-(3,4-dichlorophenyl)-3-methoxybenzene (PubChem CID 86183672) has the molecular formula C13H7Cl5O and a molecular weight of 356.46 g/mol. Its IUPAC name is 1,2,4-trichloro-5-(3,4-dichlorophenyl)-3-methoxybenzene.
| Compound Name | 1,2,4-trichloro-5-(3,4-dichlorophenyl)-3-methoxybenzene |
|---|---|
| PubChem CID | 86183672 |
| Molecular Formula | C13H7Cl5O |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 353.89 |
| IUPAC Name | 1,2,4-trichloro-5-(3,4-dichlorophenyl)-3-methoxybenzene |
| SMILES | COc1c(Cl)c(Cl)cc(-c2ccc(Cl)c(Cl)c2)c1Cl |
| InChI | InChI=1S/C13H7Cl5O/c1-19-13-11(17)7(5-10(16)12(13)18)6-2-3-8(14)9(15)4-6/h2-5H,1H3 |
| InChIKey | JHESGKURHZRSLR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|