C15H7Cl3O2S — CID 86186524
6-chloro-4-(2,6-dichlorophenyl)sulfanylchromen-2-one (PubChem CID 86186524) has the molecular formula C15H7Cl3O2S and a molecular weight of 357.65 g/mol. Its IUPAC name is 6-chloro-4-(2,6-dichlorophenyl)sulfanylchromen-2-one.
| Compound Name | 6-chloro-4-(2,6-dichlorophenyl)sulfanylchromen-2-one |
|---|---|
| PubChem CID | 86186524 |
| Molecular Formula | C15H7Cl3O2S |
| Molecular Weight | 357.65 g/mol |
| Exact Mass | 355.92 |
| IUPAC Name | 6-chloro-4-(2,6-dichlorophenyl)sulfanylchromen-2-one |
| SMILES | O=c1cc(Sc2c(Cl)cccc2Cl)c2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C15H7Cl3O2S/c16-8-4-5-12-9(6-8)13(7-14(19)20-12)21-15-10(17)2-1-3-11(15)18/h1-7H |
| InChIKey | HESYPDYRBFZDKL-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.65 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|