C10H18BrN — CID 86189843
2-bromo-N,N-diethylcyclohex-2-en-1-amine (PubChem CID 86189843) has the molecular formula C10H18BrN and a molecular weight of 232.16 g/mol. Its IUPAC name is 2-bromo-N,N-diethylcyclohex-2-en-1-amine.
| Compound Name | 2-bromo-N,N-diethylcyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 86189843 |
| Molecular Formula | C10H18BrN |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 2-bromo-N,N-diethylcyclohex-2-en-1-amine |
| SMILES | CCN(CC)C1CCCC=C1Br |
| InChI | InChI=1S/C10H18BrN/c1-3-12(4-2)10-8-6-5-7-9(10)11/h7,10H,3-6,8H2,1-2H3 |
| InChIKey | FIXDXYBCZKWIQP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |