C16H37NO2Si — CID 86200813
2-amino-2-[3-[dimethyl(octyl)silyl]propyl]propane-1,3-diol (PubChem CID 86200813) has the molecular formula C16H37NO2Si and a molecular weight of 303.56 g/mol. Its IUPAC name is 2-amino-2-[3-[dimethyl(octyl)silyl]propyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[3-[dimethyl(octyl)silyl]propyl]propane-1,3-diol |
|---|---|
| PubChem CID | 86200813 |
| Molecular Formula | C16H37NO2Si |
| Molecular Weight | 303.56 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | 2-amino-2-[3-[dimethyl(octyl)silyl]propyl]propane-1,3-diol |
| SMILES | CCCCCCCC[Si](C)(C)CCCC(N)(CO)CO |
| InChI | InChI=1S/C16H37NO2Si/c1-4-5-6-7-8-9-12-20(2,3)13-10-11-16(17,14-18)15-19/h18-19H,4-15,17H2,1-3H3 |
| InChIKey | FOLARJPVCDBJHY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|