About CID 86206098
CID 86206098 (PubChem CID 86206098) has the molecular formula C11H9+
and a molecular weight of 141.19 g/mol.
Molecular Properties
| Compound Name | CID 86206098 |
| PubChem CID | 86206098 |
| Molecular Formula | C11H9+ |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.07 |
| IUPAC Name | — |
| SMILES | [CH2+]c1cccc2ccccc12 |
| InChI | InChI=1S/C11H9/c1-9-5-4-7-10-6-2-3-8-11(9)10/h2-8H,1H2/q+1 |
| InChIKey | ZTPFMGARSNKKTI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 86206098 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 86206098?
The IUPAC name of CID 86206098 (CID 86206098) is not available.
What is the SMILES notation for CID 86206098?
The canonical SMILES for CID 86206098 is [CH2+]c1cccc2ccccc12.
What is the InChIKey of CID 86206098?
The InChIKey is ZTPFMGARSNKKTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9/c1-9-5-4-7-10-6-2-3-8-11(9)10/h2-8H,1H2/q+1.
What are the key properties of CID 86206098?
CID 86206098 has a molecular weight of 141.19 g/mol, XLogP of 3.02, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 86206098 is sourced from PubChem (CID 86206098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).