C19H19N3O — CID 86217446
2-(4-methyl-3-pyridinyl)-4-(4-pyrrolidin-1-ylphenyl)-1,3-oxazole (PubChem CID 86217446) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-(4-methyl-3-pyridinyl)-4-(4-pyrrolidin-1-ylphenyl)-1,3-oxazole.
| Compound Name | 2-(4-methyl-3-pyridinyl)-4-(4-pyrrolidin-1-ylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 86217446 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 2-(4-methyl-3-pyridinyl)-4-(4-pyrrolidin-1-ylphenyl)-1,3-oxazole |
| SMILES | Cc1ccncc1-c1nc(-c2ccc(N3CCCC3)cc2)co1 |
| InChI | InChI=1S/C19H19N3O/c1-14-8-9-20-12-17(14)19-21-18(13-23-19)15-4-6-16(7-5-15)22-10-2-3-11-22/h4-9,12-13H,2-3,10-11H2,1H3 |
| InChIKey | INXGLFYQLFOZQS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |