C25H27N7 — CID 170311040
4-[4-(4-methylpiperazin-1-yl)phenyl]-8-(4-methyl-3-pyridinyl)quinazoline-2,5-diamine (PubChem CID 170311040) has the molecular formula C25H27N7 and a molecular weight of 425.54 g/mol. Its IUPAC name is 4-[4-(4-methylpiperazin-1-yl)phenyl]-8-(4-methyl-3-pyridinyl)quinazoline-2,5-diamine.
| Compound Name | 4-[4-(4-methylpiperazin-1-yl)phenyl]-8-(4-methyl-3-pyridinyl)quinazoline-2,5-diamine |
|---|---|
| PubChem CID | 170311040 |
| Molecular Formula | C25H27N7 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 4-[4-(4-methylpiperazin-1-yl)phenyl]-8-(4-methyl-3-pyridinyl)quinazoline-2,5-diamine |
| SMILES | Cc1ccncc1-c1ccc(N)c2c(-c3ccc(N4CCN(C)CC4)cc3)nc(N)nc12 |
| InChI | InChI=1S/C25H27N7/c1-16-9-10-28-15-20(16)19-7-8-21(26)22-23(29-25(27)30-24(19)22)17-3-5-18(6-4-17)32-13-11-31(2)12-14-32/h3-10,15H,11-14,26H2,1-2H3,(H2,27,29,30) |
| InChIKey | LEDSBFHRFWVSOH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|