C25H29N7 — CID 175956399
2-[4-(4-methylpiperazin-1-yl)phenyl]-8-(4-methyl-3-pyridinyl)-1H-quinazoline-2,5-diamine (PubChem CID 175956399) has the molecular formula C25H29N7 and a molecular weight of 427.56 g/mol. Its IUPAC name is 2-[4-(4-methylpiperazin-1-yl)phenyl]-8-(4-methyl-3-pyridinyl)-1H-quinazoline-2,5-diamine.
| Compound Name | 2-[4-(4-methylpiperazin-1-yl)phenyl]-8-(4-methyl-3-pyridinyl)-1H-quinazoline-2,5-diamine |
|---|---|
| PubChem CID | 175956399 |
| Molecular Formula | C25H29N7 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 2-[4-(4-methylpiperazin-1-yl)phenyl]-8-(4-methyl-3-pyridinyl)-1H-quinazoline-2,5-diamine |
| SMILES | Cc1ccncc1-c1ccc(N)c2c1NC(N)(c1ccc(N3CCN(C)CC3)cc1)N=C2 |
| InChI | InChI=1S/C25H29N7/c1-17-9-10-28-15-21(17)20-7-8-23(26)22-16-29-25(27,30-24(20)22)18-3-5-19(6-4-18)32-13-11-31(2)12-14-32/h3-10,15-16,30H,11-14,26-27H2,1-2H3 |
| InChIKey | VYOWLNYQKUZKNO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 95.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|