C23H25N7 — CID 175956391
2-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)-8-(4-methyl-3-pyridinyl)-1H-quinazoline-2,5-diamine (PubChem CID 175956391) has the molecular formula C23H25N7 and a molecular weight of 399.50 g/mol. Its IUPAC name is 2-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)-8-(4-methyl-3-pyridinyl)-1H-quinazoline-2,5-diamine.
| Compound Name | 2-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)-8-(4-methyl-3-pyridinyl)-1H-quinazoline-2,5-diamine |
|---|---|
| PubChem CID | 175956391 |
| Molecular Formula | C23H25N7 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 2-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)-8-(4-methyl-3-pyridinyl)-1H-quinazoline-2,5-diamine |
| SMILES | Cc1ccncc1-c1ccc(N)c2c1NC(N)(c1cnc3c(c1)CN(C)CC3)N=C2 |
| InChI | InChI=1S/C23H25N7/c1-14-5-7-26-11-18(14)17-3-4-20(24)19-12-28-23(25,29-22(17)19)16-9-15-13-30(2)8-6-21(15)27-10-16/h3-5,7,9-12,29H,6,8,13,24-25H2,1-2H3 |
| InChIKey | NTNMTSQCSQUFTR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|