C12H18N6 — CID 143718971
3-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-1,2-dihydro-1,2,4-triazole-3,5-diamine (PubChem CID 143718971) has the molecular formula C12H18N6 and a molecular weight of 246.32 g/mol. Its IUPAC name is 3-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-1,2-dihydro-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-1,2-dihydro-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 143718971 |
| Molecular Formula | C12H18N6 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 3-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-1,2-dihydro-1,2,4-triazole-3,5-diamine |
| SMILES | CN1CCc2ccc(C3(N)N=C(N)NN3)cc2C1 |
| InChI | InChI=1S/C12H18N6/c1-18-5-4-8-2-3-10(6-9(8)7-18)12(14)15-11(13)16-17-12/h2-3,6,17H,4-5,7,14H2,1H3,(H3,13,15,16) |
| InChIKey | LFGDEXPDAZOVGO-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 91.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |