C19H23N5O — CID 170431197
2-(6-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-1H-quinazoline-2,7-diamine (PubChem CID 170431197) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is 2-(6-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-1H-quinazoline-2,7-diamine.
| Compound Name | 2-(6-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-1H-quinazoline-2,7-diamine |
|---|---|
| PubChem CID | 170431197 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 2-(6-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-1H-quinazoline-2,7-diamine |
| SMILES | COc1cc2c(cc1C1(N)N=Cc3ccc(N)cc3N1)CN(C)CC2 |
| InChI | InChI=1S/C19H23N5O/c1-24-6-5-12-8-18(25-2)16(7-14(12)11-24)19(21)22-10-13-3-4-15(20)9-17(13)23-19/h3-4,7-10,23H,5-6,11,20-21H2,1-2H3 |
| InChIKey | ZKRAVCOKUMCFOZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 88.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|