About S-benzyl 3-hydroxy-4-methylpentanethioate
S-benzyl 3-hydroxy-4-methylpentanethioate (PubChem CID 86217533) has the molecular formula C13H18O2S
and a molecular weight of 238.35 g/mol. Its IUPAC name is S-benzyl 3-hydroxy-4-methylpentanethioate.
Molecular Properties
| Compound Name | S-benzyl 3-hydroxy-4-methylpentanethioate |
| PubChem CID | 86217533 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | S-benzyl 3-hydroxy-4-methylpentanethioate |
| SMILES | CC(C)C(O)CC(=O)SCc1ccccc1 |
| InChI | InChI=1S/C13H18O2S/c1-10(2)12(14)8-13(15)16-9-11-6-4-3-5-7-11/h3-7,10,12,14H,8-9H2,1-2H3 |
| InChIKey | LWEZNEUEOVOAQR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-benzyl 3-hydroxy-4-methylpentanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-benzyl 3-hydroxy-4-methylpentanethioate?
The IUPAC name of S-benzyl 3-hydroxy-4-methylpentanethioate (CID 86217533) is S-benzyl 3-hydroxy-4-methylpentanethioate.
What is the SMILES notation for S-benzyl 3-hydroxy-4-methylpentanethioate?
The canonical SMILES for S-benzyl 3-hydroxy-4-methylpentanethioate is CC(C)C(O)CC(=O)SCc1ccccc1.
What is the InChIKey of S-benzyl 3-hydroxy-4-methylpentanethioate?
The InChIKey is LWEZNEUEOVOAQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2S/c1-10(2)12(14)8-13(15)16-9-11-6-4-3-5-7-11/h3-7,10,12,14H,8-9H2,1-2H3.
What are the key properties of S-benzyl 3-hydroxy-4-methylpentanethioate?
S-benzyl 3-hydroxy-4-methylpentanethioate has a molecular weight of 238.35 g/mol, XLogP of 2.85, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-benzyl 3-hydroxy-4-methylpentanethioate is sourced from PubChem (CID 86217533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).