C30H22N2O4 — CID 86226986
2,6-diphenylterephthalic acid;4-pyridin-4-ylpyridine (PubChem CID 86226986) has the molecular formula C30H22N2O4 and a molecular weight of 474.52 g/mol. Its IUPAC name is 2,6-diphenylterephthalic acid;4-pyridin-4-ylpyridine.
| Compound Name | 2,6-diphenylterephthalic acid;4-pyridin-4-ylpyridine |
|---|---|
| PubChem CID | 86226986 |
| Molecular Formula | C30H22N2O4 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 2,6-diphenylterephthalic acid;4-pyridin-4-ylpyridine |
| SMILES | O=C(O)c1cc(-c2ccccc2)c(C(=O)O)c(-c2ccccc2)c1.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C20H14O4.C10H8N2/c21-19(22)15-11-16(13-7-3-1-4-8-13)18(20(23)24)17(12-15)14-9-5-2-6-10-14;1-5-11-6-2-9(1)10-3-7-12-8-4-10/h1-12H,(H,21,22)(H,23,24);1-8H |
| InChIKey | XFVKXRQTCRCYJJ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |