About dibenzyl(methoxy)borane
dibenzyl(methoxy)borane (PubChem CID 86227149) has the molecular formula C15H17BO
and a molecular weight of 224.11 g/mol. Its IUPAC name is dibenzyl(methoxy)borane.
Molecular Properties
| Compound Name | dibenzyl(methoxy)borane |
| PubChem CID | 86227149 |
| Molecular Formula | C15H17BO |
| Molecular Weight | 224.11 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | dibenzyl(methoxy)borane |
| SMILES | COB(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C15H17BO/c1-17-16(12-14-8-4-2-5-9-14)13-15-10-6-3-7-11-15/h2-11H,12-13H2,1H3 |
| InChIKey | CZLXNIDXXDHISO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.11 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dibenzyl(methoxy)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl(methoxy)borane?
The IUPAC name of dibenzyl(methoxy)borane (CID 86227149) is dibenzyl(methoxy)borane.
What is the SMILES notation for dibenzyl(methoxy)borane?
The canonical SMILES for dibenzyl(methoxy)borane is COB(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of dibenzyl(methoxy)borane?
The InChIKey is CZLXNIDXXDHISO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17BO/c1-17-16(12-14-8-4-2-5-9-14)13-15-10-6-3-7-11-15/h2-11H,12-13H2,1H3.
What are the key properties of dibenzyl(methoxy)borane?
dibenzyl(methoxy)borane has a molecular weight of 224.11 g/mol, XLogP of 3.19, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl(methoxy)borane is sourced from PubChem (CID 86227149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).