C16H16N2O2 — CID 86230595
ethyl 1-cyano-1-prop-2-enylisoquinoline-2-carboxylate (PubChem CID 86230595) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is ethyl 1-cyano-1-prop-2-enylisoquinoline-2-carboxylate.
| Compound Name | ethyl 1-cyano-1-prop-2-enylisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 86230595 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | ethyl 1-cyano-1-prop-2-enylisoquinoline-2-carboxylate |
| SMILES | C=CCC1(C#N)c2ccccc2C=CN1C(=O)OCC |
| InChI | InChI=1S/C16H16N2O2/c1-3-10-16(12-17)14-8-6-5-7-13(14)9-11-18(16)15(19)20-4-2/h3,5-9,11H,1,4,10H2,2H3 |
| InChIKey | WJNXNXQHMYJDLI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|