C10H17N3 — CID 86231913
2-(4a,5,6,7,8,8a-hexahydro-1,8-naphthyridin-2-yl)ethanamine (PubChem CID 86231913) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 2-(4a,5,6,7,8,8a-hexahydro-1,8-naphthyridin-2-yl)ethanamine.
| Compound Name | 2-(4a,5,6,7,8,8a-hexahydro-1,8-naphthyridin-2-yl)ethanamine |
|---|---|
| PubChem CID | 86231913 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 2-(4a,5,6,7,8,8a-hexahydro-1,8-naphthyridin-2-yl)ethanamine |
| SMILES | NCCC1=NC2NCCCC2C=C1 |
| InChI | InChI=1S/C10H17N3/c11-6-5-9-4-3-8-2-1-7-12-10(8)13-9/h3-4,8,10,12H,1-2,5-7,11H2 |
| InChIKey | RESVSKMODVJFTJ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |