C19H28OSi — CID 86234069
2,2-dimethyl-1-(4-methylphenyl)-4-triethylsilylbut-3-yn-1-one (PubChem CID 86234069) has the molecular formula C19H28OSi and a molecular weight of 300.52 g/mol. Its IUPAC name is 2,2-dimethyl-1-(4-methylphenyl)-4-triethylsilylbut-3-yn-1-one.
| Compound Name | 2,2-dimethyl-1-(4-methylphenyl)-4-triethylsilylbut-3-yn-1-one |
|---|---|
| PubChem CID | 86234069 |
| Molecular Formula | C19H28OSi |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 2,2-dimethyl-1-(4-methylphenyl)-4-triethylsilylbut-3-yn-1-one |
| SMILES | CC[Si](C#CC(C)(C)C(=O)c1ccc(C)cc1)(CC)CC |
| InChI | InChI=1S/C19H28OSi/c1-7-21(8-2,9-3)15-14-19(5,6)18(20)17-12-10-16(4)11-13-17/h10-13H,7-9H2,1-6H3 |
| InChIKey | SCOXHGBLAXKQDL-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|