C12H18SSe — CID 86244053
1-methylsulfanyl-2,2-bis(prop-2-enyl)pent-4-ene-1-selone (PubChem CID 86244053) has the molecular formula C12H18SSe and a molecular weight of 273.30 g/mol. Its IUPAC name is 1-methylsulfanyl-2,2-bis(prop-2-enyl)pent-4-ene-1-selone.
| Compound Name | 1-methylsulfanyl-2,2-bis(prop-2-enyl)pent-4-ene-1-selone |
|---|---|
| PubChem CID | 86244053 |
| Molecular Formula | C12H18SSe |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 1-methylsulfanyl-2,2-bis(prop-2-enyl)pent-4-ene-1-selone |
| SMILES | C=CCC(CC=C)(CC=C)C(=[Se])SC |
| InChI | InChI=1S/C12H18SSe/c1-5-8-12(9-6-2,10-7-3)11(14)13-4/h5-7H,1-3,8-10H2,4H3 |
| InChIKey | GDMGPJLHRKNHQB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|