C16H28SSe — CID 15203261
1-butylsulfanyl-2,2-bis(prop-2-enyl)hexane-1-selone (PubChem CID 15203261) has the molecular formula C16H28SSe and a molecular weight of 331.43 g/mol. Its IUPAC name is 1-butylsulfanyl-2,2-bis(prop-2-enyl)hexane-1-selone.
| Compound Name | 1-butylsulfanyl-2,2-bis(prop-2-enyl)hexane-1-selone |
|---|---|
| PubChem CID | 15203261 |
| Molecular Formula | C16H28SSe |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1-butylsulfanyl-2,2-bis(prop-2-enyl)hexane-1-selone |
| SMILES | C=CCC(CC=C)(CCCC)C(=[Se])SCCCC |
| InChI | InChI=1S/C16H28SSe/c1-5-9-13-16(11-7-3,12-8-4)15(18)17-14-10-6-2/h7-8H,3-6,9-14H2,1-2H3 |
| InChIKey | GWMYFCOUYSMBRB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|