C20H12 — CID 86246732
pentacyclo[10.8.0.02,9.04,8.013,19]icosa-1(20),2(9),3,5,7,10,12,14,16,18-decaene (PubChem CID 86246732) has the molecular formula C20H12 and a molecular weight of 252.32 g/mol. Its IUPAC name is pentacyclo[10.8.0.02,9.04,8.013,19]icosa-1(20),2(9),3,5,7,10,12,14,16,18-decaene.
| Compound Name | pentacyclo[10.8.0.02,9.04,8.013,19]icosa-1(20),2(9),3,5,7,10,12,14,16,18-decaene |
|---|---|
| PubChem CID | 86246732 |
| Molecular Formula | C20H12 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | pentacyclo[10.8.0.02,9.04,8.013,19]icosa-1(20),2(9),3,5,7,10,12,14,16,18-decaene |
| SMILES | C1=CC2=Cc3c(ccc4c5cccccc-5cc34)C2=C1 |
| InChI | InChI=1S/C20H12/c1-2-5-13-11-19-17(15(13)7-3-1)9-10-18-16-8-4-6-14(16)12-20(18)19/h1-12H |
| InChIKey | BQISYIQUHSBPGP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |