C16H15ClFNO5S — CID 8625044
2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 5-chloro-2-fluorobenzoate (PubChem CID 8625044) has the molecular formula C16H15ClFNO5S and a molecular weight of 387.82 g/mol. Its IUPAC name is 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 5-chloro-2-fluorobenzoate.
| Compound Name | 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 5-chloro-2-fluorobenzoate |
|---|---|
| PubChem CID | 8625044 |
| Molecular Formula | C16H15ClFNO5S |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 5-chloro-2-fluorobenzoate |
| SMILES | CCOC(=O)/C=C1\SCC(=O)N1CCOC(=O)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C16H15ClFNO5S/c1-2-23-15(21)8-14-19(13(20)9-25-14)5-6-24-16(22)11-7-10(17)3-4-12(11)18/h3-4,7-8H,2,5-6,9H2,1H3/b14-8- |
| InChIKey | MUAYPJGPXWPAAS-ZSOIEALJSA-N |
| XLogP | 2.62 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|